4-Methoxyisophthalic acid

China cas 2206-43-1 manufacturer wholesale 4-Methoxyisophthalic acid at affordable price We provide high quality 4-Methoxyisophthalic acid (CAS 2206-43-1), at a very affordable prices to our customers.

1.What is the 4-Methoxyisophthalic acid ?

4-Methoxyisophthalic acid is an organic compound derived from various starting materials such as its dimethyl analog, p-cresol, 4-methoxy-m-xylene, and 3-methyl-4-methoxybenzyl chloride. It is characterized by its white to off-white powdery appearance and is known for its chemical properties that make it suitable for a range of applications across different industries.

Used in Chemical Synthesis:
4-Methoxyisophthalic acid is used as a key intermediate in the synthesis of various chemical compounds, including pharmaceuticals, dyes, and other specialty chemicals. Its unique structure allows for versatile reactions and functional group manipulations, making it a valuable building block in the chemical industry.
Used in Pharmaceutical Industry:
4-Methoxyisophthalic acid is used as a starting material for the development of new drugs, particularly those targeting specific diseases. Its chemical properties enable the creation of novel molecular structures with potential therapeutic benefits.
Used in Dye Manufacturing:
In the dye industry, 4-Methoxyisophthalic acid is used as a precursor for the production of various types of dyes, including those used in textiles, plastics, and other materials. Its ability to form colored compounds makes it an essential component in the development of new and improved dyes.
Used in Polymer Production:
4-Methoxyisophthalic acid is utilized in the production of certain types of polymers, such as polyesters and polyamides. Its chemical properties contribute to the formation of polymer chains with specific characteristics, making it a valuable component in the development of new materials with tailored properties.
Used in Coatings and Adhesives:
In the coatings and adhesives industry, 4-Methoxyisophthalic acid is used to improve the performance of these materials. Its chemical properties can enhance the durability, adhesion, and other properties of coatings and adhesives, making it a valuable additive in the formulation of these products.
Used in Agriculture:
4-Methoxyisophthalic acid is employed in the agricultural industry, where it is used as a component in the development of new agrochemicals, such as pesticides and herbicides. Its unique chemical properties allow for the creation of compounds with improved efficacy and selectivity, contributing to more effective and environmentally friendly agricultural practices.

2.What is the CAS number for 4-Methoxyisophthalic acid ?

The CAS number of 4-Methoxyisophthalic acid is 2206-43-1.

More information of 4-Methoxyisophthalic acid 2206-43-1 are:

3.What is the molecular formula of 4-Methoxyisophthalic acid ?

The chemical formula of?4-Methoxyisophthalic acid is C9H8O5 which containing 9 Carbon atoms,8 Hydrogen atoms and 5 Oxygen atoms,and the molecular weight, and the molecular weight of 4-Methoxyisophthalic acid is 196.16

4.What is 4-Methoxyisophthalic acid(2206-43-1)used for?

4-Methoxyisophthalic acid is an organic compound derived from various starting materials such as its dimethyl analog, p-cresol, 4-methoxy-m-xylene, and 3-methyl-4-methoxybenzyl chloride. It is characterized by its white to off-white powdery appearance and is known for its chemical properties that make it suitable for a range of applications across different industries.

InChI:InChI=1/C9H8O5/c1-14-7-3-2-5(8(10)11)4-6(7)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)

Relevant articles related to 4-Methoxyisophthalic acid:

5.China cas 2206-43-1 manufacturer wholesale 4-Methoxyisophthalic acid at affordable price

Hebei chongbao biological technology co., LTD is a quality supplier of 4-Methoxyisophthalic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 4-Methoxyisophthalic acid 2206-43-1.